C21H19N3O4 — CID 34255025
N'-(1,3-benzodioxole-5-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide (PubChem CID 34255025) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is N'-(1,3-benzodioxole-5-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide.
| Compound Name | N'-(1,3-benzodioxole-5-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide |
|---|---|
| PubChem CID | 34255025 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N'-(1,3-benzodioxole-5-carbonyl)-6,7,8,9-tetrahydro-5H-carbazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2[nH]c3c(c2c1)CCCC3)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H19N3O4/c25-20(23-24-21(26)13-6-8-18-19(10-13)28-11-27-18)12-5-7-17-15(9-12)14-3-1-2-4-16(14)22-17/h5-10,22H,1-4,11H2,(H,23,25)(H,24,26) |
| InChIKey | UDTBINWHULYCOU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|