C21H28N2O2 — CID 71754454
N-(2,2-dimethyloxan-4-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide (PubChem CID 71754454) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(2,2-dimethyloxan-4-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide.
| Compound Name | N-(2,2-dimethyloxan-4-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide |
|---|---|
| PubChem CID | 71754454 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-(2,2-dimethyloxan-4-yl)-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2ccc3[nH]c4c(c3c2)CCCCC4)CCO1 |
| InChI | InChI=1S/C21H28N2O2/c1-21(2)13-15(10-11-25-21)22-20(24)14-8-9-19-17(12-14)16-6-4-3-5-7-18(16)23-19/h8-9,12,15,23H,3-7,10-11,13H2,1-2H3,(H,22,24) |
| InChIKey | RQSXMUNZCHBRIZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|