C22H25N5O — CID 55721169
N-(1-pyrimidin-2-ylpiperidin-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 55721169) has the molecular formula C22H25N5O and a molecular weight of 375.48 g/mol. Its IUPAC name is N-(1-pyrimidin-2-ylpiperidin-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-(1-pyrimidin-2-ylpiperidin-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 55721169 |
| Molecular Formula | C22H25N5O |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-(1-pyrimidin-2-ylpiperidin-4-yl)-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(NC1CCN(c2ncccn2)CC1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C22H25N5O/c28-21(25-16-8-12-27(13-9-16)22-23-10-3-11-24-22)15-6-7-20-18(14-15)17-4-1-2-5-19(17)26-20/h3,6-7,10-11,14,16,26H,1-2,4-5,8-9,12-13H2,(H,25,28) |
| InChIKey | PFYASLQHPNUSAR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|