C23H25N3O3 — CID 134000227
N-[1-(furan-2-carbonyl)piperidin-4-yl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 134000227) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 134000227 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccco2)CC1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C23H25N3O3/c27-22(15-7-8-20-18(14-15)17-4-1-2-5-19(17)25-20)24-16-9-11-26(12-10-16)23(28)21-6-3-13-29-21/h3,6-8,13-14,16,25H,1-2,4-5,9-12H2,(H,24,27) |
| InChIKey | SQZCDCGULYLTFL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|