C16H16FN3O3 — CID 136514589
5-fluoro-N-[1-(furan-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 136514589) has the molecular formula C16H16FN3O3 and a molecular weight of 317.32 g/mol. Its IUPAC name is 5-fluoro-N-[1-(furan-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | 5-fluoro-N-[1-(furan-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 136514589 |
| Molecular Formula | C16H16FN3O3 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-fluoro-N-[1-(furan-2-carbonyl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccco2)CC1)c1cncc(F)c1 |
| InChI | InChI=1S/C16H16FN3O3/c17-12-8-11(9-18-10-12)15(21)19-13-3-5-20(6-4-13)16(22)14-2-1-7-23-14/h1-2,7-10,13H,3-6H2,(H,19,21) |
| InChIKey | WDPTWSIYRNSZMO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |