C17H16N4O7 — CID 134000280
N-[1-(furan-2-carbonyl)piperidin-4-yl]-3,5-dinitrobenzamide (PubChem CID 134000280) has the molecular formula C17H16N4O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is N-[1-(furan-2-carbonyl)piperidin-4-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 134000280 |
| Molecular Formula | C17H16N4O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[1-(furan-2-carbonyl)piperidin-4-yl]-3,5-dinitrobenzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccco2)CC1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N4O7/c22-16(11-8-13(20(24)25)10-14(9-11)21(26)27)18-12-3-5-19(6-4-12)17(23)15-2-1-7-28-15/h1-2,7-10,12H,3-6H2,(H,18,22) |
| InChIKey | PWFPQQWRJUOKAL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 148.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|