C25H25N3O4 — CID 55634715
3-benzamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-methylbenzamide (PubChem CID 55634715) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 3-benzamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-methylbenzamide.
| Compound Name | 3-benzamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55634715 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 3-benzamido-N-[1-(furan-2-carbonyl)piperidin-4-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=O)c3ccco3)CC2)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H25N3O4/c1-17-9-10-19(16-21(17)27-23(29)18-6-3-2-4-7-18)24(30)26-20-11-13-28(14-12-20)25(31)22-8-5-15-32-22/h2-10,15-16,20H,11-14H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | ISWJFVZDNAQSSP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |