C29H35N5O4 — CID 130372663
N-[5-[(1-acetylpiperidin-4-yl)carbamoyl]-2-[2-(2,4-dimethylanilino)ethylamino]phenyl]furan-2-carboxamide (PubChem CID 130372663) has the molecular formula C29H35N5O4 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[5-[(1-acetylpiperidin-4-yl)carbamoyl]-2-[2-(2,4-dimethylanilino)ethylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-[(1-acetylpiperidin-4-yl)carbamoyl]-2-[2-(2,4-dimethylanilino)ethylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 130372663 |
| Molecular Formula | C29H35N5O4 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | N-[5-[(1-acetylpiperidin-4-yl)carbamoyl]-2-[2-(2,4-dimethylanilino)ethylamino]phenyl]furan-2-carboxamide |
| SMILES | CC(=O)N1CCC(NC(=O)c2ccc(NCCNc3ccc(C)cc3C)c(NC(=O)c3ccco3)c2)CC1 |
| InChI | InChI=1S/C29H35N5O4/c1-19-6-8-24(20(2)17-19)30-12-13-31-25-9-7-22(18-26(25)33-29(37)27-5-4-16-38-27)28(36)32-23-10-14-34(15-11-23)21(3)35/h4-9,16-18,23,30-31H,10-15H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | OHQQUXQDHGQIJU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|