C19H23N3O2S — CID 3218735
N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]furan-2-carboxamide (PubChem CID 3218735) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]furan-2-carboxamide.
| Compound Name | N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3218735 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=S)N2CCC(NC(=O)c3ccco3)CC2)cc1C |
| InChI | InChI=1S/C19H23N3O2S/c1-13-5-6-16(12-14(13)2)21-19(25)22-9-7-15(8-10-22)20-18(23)17-4-3-11-24-17/h3-6,11-12,15H,7-10H2,1-2H3,(H,20,23)(H,21,25) |
| InChIKey | LFZWMZBOENVCEY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|