C22H27N3OS — CID 43814172
N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-4-methylbenzamide (PubChem CID 43814172) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-4-methylbenzamide.
| Compound Name | N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 43814172 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[1-[(3,4-dimethylphenyl)carbamothioyl]piperidin-4-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(C(=S)Nc3ccc(C)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3OS/c1-15-4-7-18(8-5-15)21(26)23-19-10-12-25(13-11-19)22(27)24-20-9-6-16(2)17(3)14-20/h4-9,14,19H,10-13H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | UHAJABOUVLWALW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|