C25H29FN4O2S — CID 93200508
N-[(1S)-2-(cyclopropylamino)-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-4-methylbenzamide (PubChem CID 93200508) has the molecular formula C25H29FN4O2S and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[(1S)-2-(cyclopropylamino)-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-4-methylbenzamide.
| Compound Name | N-[(1S)-2-(cyclopropylamino)-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 93200508 |
| Molecular Formula | C25H29FN4O2S |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[(1S)-2-(cyclopropylamino)-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)N[C@H](C(=O)NC2CC2)C2CCN(C(=S)Nc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C25H29FN4O2S/c1-16-2-4-18(5-3-16)23(31)29-22(24(32)27-20-10-11-20)17-12-14-30(15-13-17)25(33)28-21-8-6-19(26)7-9-21/h2-9,17,20,22H,10-15H2,1H3,(H,27,32)(H,28,33)(H,29,31)/t22-/m0/s1 |
| InChIKey | OZRVBXAWOQWCPB-QFIPXVFZSA-N |
| XLogP | 3.62 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|