C26H33FN4O2S — CID 93200415
N-[(1R)-2-[[(2S)-butan-2-yl]amino]-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-2-methylbenzamide (PubChem CID 93200415) has the molecular formula C26H33FN4O2S and a molecular weight of 484.64 g/mol. Its IUPAC name is N-[(1R)-2-[[(2S)-butan-2-yl]amino]-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-2-methylbenzamide.
| Compound Name | N-[(1R)-2-[[(2S)-butan-2-yl]amino]-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 93200415 |
| Molecular Formula | C26H33FN4O2S |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-[(1R)-2-[[(2S)-butan-2-yl]amino]-1-[1-[(4-fluorophenyl)carbamothioyl]piperidin-4-yl]-2-oxoethyl]-2-methylbenzamide |
| SMILES | CC[C@H](C)NC(=O)[C@H](NC(=O)c1ccccc1C)C1CCN(C(=S)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C26H33FN4O2S/c1-4-18(3)28-25(33)23(30-24(32)22-8-6-5-7-17(22)2)19-13-15-31(16-14-19)26(34)29-21-11-9-20(27)10-12-21/h5-12,18-19,23H,4,13-16H2,1-3H3,(H,28,33)(H,29,34)(H,30,32)/t18-,23+/m0/s1 |
| InChIKey | UXFDWVZYDRWVPD-FDDCHVKYSA-N |
| XLogP | 4.26 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|