C27H35N3O3 — CID 42840332
N-[2-(butan-2-ylamino)-2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]ethyl]-2-methylbenzamide (PubChem CID 42840332) has the molecular formula C27H35N3O3 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[2-(butan-2-ylamino)-2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]ethyl]-2-methylbenzamide.
| Compound Name | N-[2-(butan-2-ylamino)-2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 42840332 |
| Molecular Formula | C27H35N3O3 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | N-[2-(butan-2-ylamino)-2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]ethyl]-2-methylbenzamide |
| SMILES | CCC(C)NC(=O)C(NC(=O)c1ccccc1C)C1CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C27H35N3O3/c1-4-20(3)28-27(33)25(29-26(32)23-13-9-8-10-19(23)2)22-14-16-30(17-15-22)24(31)18-21-11-6-5-7-12-21/h5-13,20,22,25H,4,14-18H2,1-3H3,(H,28,33)(H,29,32) |
| InChIKey | ICOXNZWTBHIIET-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |