C28H35N3O3 — CID 46019098
2-methyl-N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-piperidin-1-ylethyl]benzamide (PubChem CID 46019098) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-methyl-N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-piperidin-1-ylethyl]benzamide.
| Compound Name | 2-methyl-N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 46019098 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 2-methyl-N-[2-oxo-1-[1-(2-phenylacetyl)piperidin-4-yl]-2-piperidin-1-ylethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(C(=O)N1CCCCC1)C1CCN(C(=O)Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H35N3O3/c1-21-10-6-7-13-24(21)27(33)29-26(28(34)31-16-8-3-9-17-31)23-14-18-30(19-15-23)25(32)20-22-11-4-2-5-12-22/h2,4-7,10-13,23,26H,3,8-9,14-20H2,1H3,(H,29,33) |
| InChIKey | WAEIXXKQCGINPD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |