C28H35N3O3 — CID 46019100
2-methyl-N-[1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]benzamide (PubChem CID 46019100) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 2-methyl-N-[1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]benzamide.
| Compound Name | 2-methyl-N-[1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 46019100 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 2-methyl-N-[1-[1-(2-methylbenzoyl)piperidin-4-yl]-2-oxo-2-piperidin-1-ylethyl]benzamide |
| SMILES | Cc1ccccc1C(=O)NC(C(=O)N1CCCCC1)C1CCN(C(=O)c2ccccc2C)CC1 |
| InChI | InChI=1S/C28H35N3O3/c1-20-10-4-6-12-23(20)26(32)29-25(28(34)30-16-8-3-9-17-30)22-14-18-31(19-15-22)27(33)24-13-7-5-11-21(24)2/h4-7,10-13,22,25H,3,8-9,14-19H2,1-2H3,(H,29,32) |
| InChIKey | FFALGNPWIXTDOX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |