C22H32N4O2S — CID 93200425
N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxo-2-pyrrolidin-1-ylethyl]-2-methylbenzamide (PubChem CID 93200425) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxo-2-pyrrolidin-1-ylethyl]-2-methylbenzamide.
| Compound Name | N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxo-2-pyrrolidin-1-ylethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 93200425 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxo-2-pyrrolidin-1-ylethyl]-2-methylbenzamide |
| SMILES | CCNC(=S)N1CCC([C@@H](NC(=O)c2ccccc2C)C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C22H32N4O2S/c1-3-23-22(29)26-14-10-17(11-15-26)19(21(28)25-12-6-7-13-25)24-20(27)18-9-5-4-8-16(18)2/h4-5,8-9,17,19H,3,6-7,10-15H2,1-2H3,(H,23,29)(H,24,27)/t19-/m1/s1 |
| InChIKey | BFFGGUKJGGHPSX-LJQANCHMSA-N |
| XLogP | 2.32 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|