C22H34N4O3S — CID 93200421
N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide (PubChem CID 93200421) has the molecular formula C22H34N4O3S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide.
| Compound Name | N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 93200421 |
| Molecular Formula | C22H34N4O3S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[(1R)-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide |
| SMILES | CCNC(=S)N1CCC([C@@H](NC(=O)c2ccccc2C)C(=O)NCCCOC)CC1 |
| InChI | InChI=1S/C22H34N4O3S/c1-4-23-22(30)26-13-10-17(11-14-26)19(21(28)24-12-7-15-29-3)25-20(27)18-9-6-5-8-16(18)2/h5-6,8-9,17,19H,4,7,10-15H2,1-3H3,(H,23,30)(H,24,28)(H,25,27)/t19-/m1/s1 |
| InChIKey | BJKFZTJLWSXXKB-LJQANCHMSA-N |
| XLogP | 1.85 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|