C25H30ClN3O4 — CID 93196592
N-[(1R)-1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide (PubChem CID 93196592) has the molecular formula C25H30ClN3O4 and a molecular weight of 471.99 g/mol. Its IUPAC name is N-[(1R)-1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide.
| Compound Name | N-[(1R)-1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 93196592 |
| Molecular Formula | C25H30ClN3O4 |
| Molecular Weight | 471.99 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[(1R)-1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide |
| SMILES | COCCNC(=O)[C@H](NC(=O)c1ccccc1C)C1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H30ClN3O4/c1-17-5-3-4-6-21(17)23(30)28-22(24(31)27-13-16-33-2)18-11-14-29(15-12-18)25(32)19-7-9-20(26)10-8-19/h3-10,18,22H,11-16H2,1-2H3,(H,27,31)(H,28,30)/t22-/m1/s1 |
| InChIKey | UWEOMZMGKPATIK-JOCHJYFZSA-N |
| XLogP | 3.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.99 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|