C24H27F2N3O4 — CID 93196379
2-fluoro-N-[(1R)-1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide (PubChem CID 93196379) has the molecular formula C24H27F2N3O4 and a molecular weight of 459.49 g/mol. Its IUPAC name is 2-fluoro-N-[(1R)-1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-N-[(1R)-1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93196379 |
| Molecular Formula | C24H27F2N3O4 |
| Molecular Weight | 459.49 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-fluoro-N-[(1R)-1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
| SMILES | COCCNC(=O)[C@H](NC(=O)c1ccccc1F)C1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C24H27F2N3O4/c1-33-15-12-27-23(31)21(28-22(30)17-6-2-4-8-19(17)25)16-10-13-29(14-11-16)24(32)18-7-3-5-9-20(18)26/h2-9,16,21H,10-15H2,1H3,(H,27,31)(H,28,30)/t21-/m1/s1 |
| InChIKey | KYDSWAHLCRZFBV-OAQYLSRUSA-N |
| XLogP | 2.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|