C24H36FN3O4 — CID 93196483
N-[(1S)-1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-fluorobenzamide (PubChem CID 93196483) has the molecular formula C24H36FN3O4 and a molecular weight of 449.57 g/mol. Its IUPAC name is N-[(1S)-1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[(1S)-1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 93196483 |
| Molecular Formula | C24H36FN3O4 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | N-[(1S)-1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-fluorobenzamide |
| SMILES | COCCCNC(=O)[C@@H](NC(=O)c1ccccc1F)C1CCN(C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H36FN3O4/c1-24(2,3)16-20(29)28-13-10-17(11-14-28)21(23(31)26-12-7-15-32-4)27-22(30)18-8-5-6-9-19(18)25/h5-6,8-9,17,21H,7,10-16H2,1-4H3,(H,26,31)(H,27,30)/t21-/m0/s1 |
| InChIKey | RJKHHEOPJQEJPR-NRFANRHFSA-N |
| XLogP | 2.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|