C24H35N3O6 — CID 46019925
N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 46019925) has the molecular formula C24H35N3O6 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46019925 |
| Molecular Formula | C24H35N3O6 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COCCNC(=O)C(NC(=O)c1ccc2c(c1)OCO2)C1CCN(C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H35N3O6/c1-24(2,3)14-20(28)27-10-7-16(8-11-27)21(23(30)25-9-12-31-4)26-22(29)17-5-6-18-19(13-17)33-15-32-18/h5-6,13,16,21H,7-12,14-15H2,1-4H3,(H,25,30)(H,26,29) |
| InChIKey | LSHUGTHREULVOQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|