C25H28FN3O6 — CID 46019927
N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 46019927) has the molecular formula C25H28FN3O6 and a molecular weight of 485.51 g/mol. Its IUPAC name is N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46019927 |
| Molecular Formula | C25H28FN3O6 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | COCCNC(=O)C(NC(=O)c1ccc2c(c1)OCO2)C1CCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C25H28FN3O6/c1-33-12-9-27-24(31)22(28-23(30)17-5-6-20-21(14-17)35-15-34-20)16-7-10-29(11-8-16)25(32)18-3-2-4-19(26)13-18/h2-6,13-14,16,22H,7-12,15H2,1H3,(H,27,31)(H,28,30) |
| InChIKey | ZWTJLJBWMJRGEP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|