C25H30FN3O5 — CID 93198154
N-[(1R)-1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-3-methoxybenzamide (PubChem CID 93198154) has the molecular formula C25H30FN3O5 and a molecular weight of 471.53 g/mol. Its IUPAC name is N-[(1R)-1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-3-methoxybenzamide.
| Compound Name | N-[(1R)-1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 93198154 |
| Molecular Formula | C25H30FN3O5 |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | N-[(1R)-1-[1-(3-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-3-methoxybenzamide |
| SMILES | COCCNC(=O)[C@H](NC(=O)c1cccc(OC)c1)C1CCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C25H30FN3O5/c1-33-14-11-27-24(31)22(28-23(30)18-5-4-8-21(16-18)34-2)17-9-12-29(13-10-17)25(32)19-6-3-7-20(26)15-19/h3-8,15-17,22H,9-14H2,1-2H3,(H,27,31)(H,28,30)/t22-/m1/s1 |
| InChIKey | BGSSPFAZGSHVFB-JOCHJYFZSA-N |
| XLogP | 2.25 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|