C24H28FN3O4 — CID 93199300
N-[(1R)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide (PubChem CID 93199300) has the molecular formula C24H28FN3O4 and a molecular weight of 441.50 g/mol. Its IUPAC name is N-[(1R)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide.
| Compound Name | N-[(1R)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93199300 |
| Molecular Formula | C24H28FN3O4 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[(1R)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
| SMILES | COCCNC(=O)[C@H](NC(=O)c1ccccc1)C1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C24H28FN3O4/c1-32-16-13-26-23(30)21(27-22(29)18-5-3-2-4-6-18)17-11-14-28(15-12-17)24(31)19-7-9-20(25)10-8-19/h2-10,17,21H,11-16H2,1H3,(H,26,30)(H,27,29)/t21-/m1/s1 |
| InChIKey | QMTSCXPYEHKTNS-OAQYLSRUSA-N |
| XLogP | 2.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|