C28H28FN3O3 — CID 93199377
N-[(1S)-2-(benzylamino)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-oxoethyl]benzamide (PubChem CID 93199377) has the molecular formula C28H28FN3O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is N-[(1S)-2-(benzylamino)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[(1S)-2-(benzylamino)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93199377 |
| Molecular Formula | C28H28FN3O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | N-[(1S)-2-(benzylamino)-1-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(N[C@H](C(=O)NCc1ccccc1)C1CCN(C(=O)c2ccc(F)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H28FN3O3/c29-24-13-11-23(12-14-24)28(35)32-17-15-21(16-18-32)25(31-26(33)22-9-5-2-6-10-22)27(34)30-19-20-7-3-1-4-8-20/h1-14,21,25H,15-19H2,(H,30,34)(H,31,33)/t25-/m0/s1 |
| InChIKey | NLWOZUSJYHSQRL-VWLOTQADSA-N |
| XLogP | 3.79 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |