C26H27N3O4 — CID 93199355
N-[(1R)-1-(1-benzoylpiperidin-4-yl)-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide (PubChem CID 93199355) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[(1R)-1-(1-benzoylpiperidin-4-yl)-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide.
| Compound Name | N-[(1R)-1-(1-benzoylpiperidin-4-yl)-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93199355 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | N-[(1R)-1-(1-benzoylpiperidin-4-yl)-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
| SMILES | O=C(N[C@@H](C(=O)NCc1ccco1)C1CCN(C(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H27N3O4/c30-24(20-8-3-1-4-9-20)28-23(25(31)27-18-22-12-7-17-33-22)19-13-15-29(16-14-19)26(32)21-10-5-2-6-11-21/h1-12,17,19,23H,13-16,18H2,(H,27,31)(H,28,30)/t23-/m1/s1 |
| InChIKey | YWHZAPOCVMCBQF-HSZRJFAPSA-N |
| XLogP | 3.25 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |