C26H26ClN3O4 — CID 46020304
N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide (PubChem CID 46020304) has the molecular formula C26H26ClN3O4 and a molecular weight of 479.96 g/mol. Its IUPAC name is N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide.
| Compound Name | N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46020304 |
| Molecular Formula | C26H26ClN3O4 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[1-[1-(4-chlorobenzoyl)piperidin-4-yl]-2-(furan-2-ylmethylamino)-2-oxoethyl]benzamide |
| SMILES | O=C(NC(C(=O)NCc1ccco1)C1CCN(C(=O)c2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H26ClN3O4/c27-21-10-8-20(9-11-21)26(33)30-14-12-18(13-15-30)23(25(32)28-17-22-7-4-16-34-22)29-24(31)19-5-2-1-3-6-19/h1-11,16,18,23H,12-15,17H2,(H,28,32)(H,29,31) |
| InChIKey | GKDQHKYNWWQQCO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |