C23H33N3O4 — CID 93199318
N-[(1R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide (PubChem CID 93199318) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is N-[(1R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide.
| Compound Name | N-[(1R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93199318 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | N-[(1R)-1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]benzamide |
| SMILES | COCCNC(=O)[C@H](NC(=O)c1ccccc1)C1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C23H33N3O4/c1-30-16-13-24-22(28)20(25-21(27)18-7-3-2-4-8-18)17-11-14-26(15-12-17)23(29)19-9-5-6-10-19/h2-4,7-8,17,19-20H,5-6,9-16H2,1H3,(H,24,28)(H,25,27)/t20-/m1/s1 |
| InChIKey | VPZPIBIPKKSGKM-HXUWFJFHSA-N |
| XLogP | 1.98 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|