C21H32N4O4 — CID 93183233
4-[(1S)-1-benzamido-2-(3-methoxypropylamino)-2-oxoethyl]-N-ethylpiperidine-1-carboxamide (PubChem CID 93183233) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[(1S)-1-benzamido-2-(3-methoxypropylamino)-2-oxoethyl]-N-ethylpiperidine-1-carboxamide.
| Compound Name | 4-[(1S)-1-benzamido-2-(3-methoxypropylamino)-2-oxoethyl]-N-ethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 93183233 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 4-[(1S)-1-benzamido-2-(3-methoxypropylamino)-2-oxoethyl]-N-ethylpiperidine-1-carboxamide |
| SMILES | CCNC(=O)N1CCC([C@H](NC(=O)c2ccccc2)C(=O)NCCCOC)CC1 |
| InChI | InChI=1S/C21H32N4O4/c1-3-22-21(28)25-13-10-16(11-14-25)18(20(27)23-12-7-15-29-2)24-19(26)17-8-5-4-6-9-17/h4-6,8-9,16,18H,3,7,10-15H2,1-2H3,(H,22,28)(H,23,27)(H,24,26)/t18-/m0/s1 |
| InChIKey | ZADSCSGCTFJDTP-SFHVURJKSA-N |
| XLogP | 1.38 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|