C21H32N4O4S — CID 46020733
N-[1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide (PubChem CID 46020733) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide.
| Compound Name | N-[1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46020733 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide |
| SMILES | CCNC(=S)N1CCC(C(NC(=O)c2ccc(OC)cc2)C(=O)NCCOC)CC1 |
| InChI | InChI=1S/C21H32N4O4S/c1-4-22-21(30)25-12-9-15(10-13-25)18(20(27)23-11-14-28-2)24-19(26)16-5-7-17(29-3)8-6-16/h5-8,15,18H,4,9-14H2,1-3H3,(H,22,30)(H,23,27)(H,24,26) |
| InChIKey | LENKFNDYRTXTJF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|