C22H34N4O4 — CID 93200107
4-[(1R)-2-(2-methoxyethylamino)-1-[(4-methylbenzoyl)amino]-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide (PubChem CID 93200107) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is 4-[(1R)-2-(2-methoxyethylamino)-1-[(4-methylbenzoyl)amino]-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide.
| Compound Name | 4-[(1R)-2-(2-methoxyethylamino)-1-[(4-methylbenzoyl)amino]-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 93200107 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | 4-[(1R)-2-(2-methoxyethylamino)-1-[(4-methylbenzoyl)amino]-2-oxoethyl]-N-propan-2-ylpiperidine-1-carboxamide |
| SMILES | COCCNC(=O)[C@H](NC(=O)c1ccc(C)cc1)C1CCN(C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C22H34N4O4/c1-15(2)24-22(29)26-12-9-17(10-13-26)19(21(28)23-11-14-30-4)25-20(27)18-7-5-16(3)6-8-18/h5-8,15,17,19H,9-14H2,1-4H3,(H,23,28)(H,24,29)(H,25,27)/t19-/m1/s1 |
| InChIKey | AQSJJCFHSPAIDO-LJQANCHMSA-N |
| XLogP | 1.69 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|