C24H35N3O5 — CID 46019487
N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide (PubChem CID 46019487) has the molecular formula C24H35N3O5 and a molecular weight of 445.56 g/mol. Its IUPAC name is N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide.
| Compound Name | N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 46019487 |
| Molecular Formula | C24H35N3O5 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | N-[1-[1-(cyclopentanecarbonyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methoxybenzamide |
| SMILES | COCCNC(=O)C(NC(=O)c1ccc(OC)cc1)C1CCN(C(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C24H35N3O5/c1-31-16-13-25-23(29)21(26-22(28)18-7-9-20(32-2)10-8-18)17-11-14-27(15-12-17)24(30)19-5-3-4-6-19/h7-10,17,19,21H,3-6,11-16H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | FFQHIARYQBKGAF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|