C21H31N3O5 — CID 93199723
N-[(1R)-1-[1-(2-methoxyacetyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methylbenzamide (PubChem CID 93199723) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[(1R)-1-[1-(2-methoxyacetyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methylbenzamide.
| Compound Name | N-[(1R)-1-[1-(2-methoxyacetyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 93199723 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | N-[(1R)-1-[1-(2-methoxyacetyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-4-methylbenzamide |
| SMILES | COCCNC(=O)[C@H](NC(=O)c1ccc(C)cc1)C1CCN(C(=O)COC)CC1 |
| InChI | InChI=1S/C21H31N3O5/c1-15-4-6-17(7-5-15)20(26)23-19(21(27)22-10-13-28-2)16-8-11-24(12-9-16)18(25)14-29-3/h4-7,16,19H,8-14H2,1-3H3,(H,22,27)(H,23,26)/t19-/m1/s1 |
| InChIKey | JHFJPCKIOHODDV-LJQANCHMSA-N |
| XLogP | 0.74 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|