C21H32N4O2S — CID 93200487
N-[(1S)-2-[[(2S)-butan-2-yl]amino]-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]benzamide (PubChem CID 93200487) has the molecular formula C21H32N4O2S and a molecular weight of 404.58 g/mol. Its IUPAC name is N-[(1S)-2-[[(2S)-butan-2-yl]amino]-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[(1S)-2-[[(2S)-butan-2-yl]amino]-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93200487 |
| Molecular Formula | C21H32N4O2S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[(1S)-2-[[(2S)-butan-2-yl]amino]-1-[1-(ethylcarbamothioyl)piperidin-4-yl]-2-oxoethyl]benzamide |
| SMILES | CCNC(=S)N1CCC([C@H](NC(=O)c2ccccc2)C(=O)N[C@@H](C)CC)CC1 |
| InChI | InChI=1S/C21H32N4O2S/c1-4-15(3)23-20(27)18(24-19(26)17-9-7-6-8-10-17)16-11-13-25(14-12-16)21(28)22-5-2/h6-10,15-16,18H,4-5,11-14H2,1-3H3,(H,22,28)(H,23,27)(H,24,26)/t15-,18-/m0/s1 |
| InChIKey | GSUNXUMJUZYCMO-YJBOKZPZSA-N |
| XLogP | 2.31 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|