C27H35N3O5 — CID 46020533
N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-4-methylbenzamide (PubChem CID 46020533) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-4-methylbenzamide.
| Compound Name | N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46020533 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-4-methylbenzamide |
| SMILES | COCCCNC(=O)C(NC(=O)c1ccc(C)cc1)C1CCN(C(=O)c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C27H35N3O5/c1-19-8-10-21(11-9-19)25(31)29-24(26(32)28-14-5-17-34-2)20-12-15-30(16-13-20)27(33)22-6-4-7-23(18-22)35-3/h4,6-11,18,20,24H,5,12-17H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | WWAZOLFOZMSNMT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|