C22H31N3O5 — CID 42847712
N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]cyclopropanecarboxamide (PubChem CID 42847712) has the molecular formula C22H31N3O5 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]cyclopropanecarboxamide.
| Compound Name | N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 42847712 |
| Molecular Formula | C22H31N3O5 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | N-[1-[1-(3-methoxybenzoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]cyclopropanecarboxamide |
| SMILES | COCCNC(=O)C(NC(=O)C1CC1)C1CCN(C(=O)c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C22H31N3O5/c1-29-13-10-23-21(27)19(24-20(26)16-6-7-16)15-8-11-25(12-9-15)22(28)17-4-3-5-18(14-17)30-2/h3-5,14-16,19H,6-13H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | SKHSECITTLTNAP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|