C24H37N3O4 — CID 46019124
N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide (PubChem CID 46019124) has the molecular formula C24H37N3O4 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide.
| Compound Name | N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46019124 |
| Molecular Formula | C24H37N3O4 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | N-[1-[1-(3,3-dimethylbutanoyl)piperidin-4-yl]-2-(2-methoxyethylamino)-2-oxoethyl]-2-methylbenzamide |
| SMILES | COCCNC(=O)C(NC(=O)c1ccccc1C)C1CCN(C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C24H37N3O4/c1-17-8-6-7-9-19(17)22(29)26-21(23(30)25-12-15-31-5)18-10-13-27(14-11-18)20(28)16-24(2,3)4/h6-9,18,21H,10-16H2,1-5H3,(H,25,30)(H,26,29) |
| InChIKey | OGZPUHUINHUHLV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|