C25H30FN3O3 — CID 46020543
N-[1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-4-methylbenzamide (PubChem CID 46020543) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-4-methylbenzamide.
| Compound Name | N-[1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 46020543 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[1-[1-(2-fluorobenzoyl)piperidin-4-yl]-2-oxo-2-(propylamino)ethyl]-4-methylbenzamide |
| SMILES | CCCNC(=O)C(NC(=O)c1ccc(C)cc1)C1CCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C25H30FN3O3/c1-3-14-27-24(31)22(28-23(30)19-10-8-17(2)9-11-19)18-12-15-29(16-13-18)25(32)20-6-4-5-7-21(20)26/h4-11,18,22H,3,12-16H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | KQIQVQASFDTKQD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |