C25H32ClN3O5S — CID 46020822
N-[1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide (PubChem CID 46020822) has the molecular formula C25H32ClN3O5S and a molecular weight of 522.07 g/mol. Its IUPAC name is N-[1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide.
| Compound Name | N-[1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46020822 |
| Molecular Formula | C25H32ClN3O5S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[1-[1-(4-chlorophenyl)sulfonylpiperidin-4-yl]-2-(3-methoxypropylamino)-2-oxoethyl]-2-methylbenzamide |
| SMILES | COCCCNC(=O)C(NC(=O)c1ccccc1C)C1CCN(S(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C25H32ClN3O5S/c1-18-6-3-4-7-22(18)24(30)28-23(25(31)27-14-5-17-34-2)19-12-15-29(16-13-19)35(32,33)21-10-8-20(26)9-11-21/h3-4,6-11,19,23H,5,12-17H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | QHMDKVZJSDMKKO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|