C25H33N3O7S — CID 46020834
3-methoxy-N-[2-(2-methoxyethylamino)-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide (PubChem CID 46020834) has the molecular formula C25H33N3O7S and a molecular weight of 519.62 g/mol. Its IUPAC name is 3-methoxy-N-[2-(2-methoxyethylamino)-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-(2-methoxyethylamino)-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46020834 |
| Molecular Formula | C25H33N3O7S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 3-methoxy-N-[2-(2-methoxyethylamino)-1-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide |
| SMILES | COCCNC(=O)C(NC(=O)c1cccc(OC)c1)C1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O7S/c1-33-16-13-26-25(30)23(27-24(29)19-5-4-6-21(17-19)35-3)18-11-14-28(15-12-18)36(31,32)22-9-7-20(34-2)8-10-22/h4-10,17-18,23H,11-16H2,1-3H3,(H,26,30)(H,27,29) |
| InChIKey | CJZAEILAHGFKCS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|