C26H35N3O6S — CID 93200608
4-methoxy-N-[(1S)-2-(3-methoxypropylamino)-1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide (PubChem CID 93200608) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is 4-methoxy-N-[(1S)-2-(3-methoxypropylamino)-1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide.
| Compound Name | 4-methoxy-N-[(1S)-2-(3-methoxypropylamino)-1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 93200608 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 4-methoxy-N-[(1S)-2-(3-methoxypropylamino)-1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-2-oxoethyl]benzamide |
| SMILES | COCCCNC(=O)[C@@H](NC(=O)c1ccc(OC)cc1)C1CCN(S(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C26H35N3O6S/c1-19-5-11-23(12-6-19)36(32,33)29-16-13-20(14-17-29)24(26(31)27-15-4-18-34-2)28-25(30)21-7-9-22(35-3)10-8-21/h5-12,20,24H,4,13-18H2,1-3H3,(H,27,31)(H,28,30)/t24-/m0/s1 |
| InChIKey | WHSHAJUNNXUVON-DEOSSOPVSA-N |
| XLogP | 2.36 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|