C21H26N2OS — CID 5010652
N-(3,4-dimethylphenyl)-4-(2-methoxyphenyl)piperidine-1-carbothioamide (PubChem CID 5010652) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-4-(2-methoxyphenyl)piperidine-1-carbothioamide.
| Compound Name | N-(3,4-dimethylphenyl)-4-(2-methoxyphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 5010652 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | N-(3,4-dimethylphenyl)-4-(2-methoxyphenyl)piperidine-1-carbothioamide |
| SMILES | COc1ccccc1C1CCN(C(=S)Nc2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C21H26N2OS/c1-15-8-9-18(14-16(15)2)22-21(25)23-12-10-17(11-13-23)19-6-4-5-7-20(19)24-3/h4-9,14,17H,10-13H2,1-3H3,(H,22,25) |
| InChIKey | SEUOYMGFCXWJAR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|