C21H24N2O3S — CID 3779210
methyl 4-[[4-(2-methoxyphenyl)piperidine-1-carbothioyl]amino]benzoate (PubChem CID 3779210) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is methyl 4-[[4-(2-methoxyphenyl)piperidine-1-carbothioyl]amino]benzoate.
| Compound Name | methyl 4-[[4-(2-methoxyphenyl)piperidine-1-carbothioyl]amino]benzoate |
|---|---|
| PubChem CID | 3779210 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | methyl 4-[[4-(2-methoxyphenyl)piperidine-1-carbothioyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=S)N2CCC(c3ccccc3OC)CC2)cc1 |
| InChI | InChI=1S/C21H24N2O3S/c1-25-19-6-4-3-5-18(19)15-11-13-23(14-12-15)21(27)22-17-9-7-16(8-10-17)20(24)26-2/h3-10,15H,11-14H2,1-2H3,(H,22,27) |
| InChIKey | KOECDSUCRKBGOZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|