C19H20Br2N2O2 — CID 3746837
N-(2,4-dibromophenyl)-4-(2-methoxyphenyl)piperidine-1-carboxamide (PubChem CID 3746837) has the molecular formula C19H20Br2N2O2 and a molecular weight of 468.19 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-4-(2-methoxyphenyl)piperidine-1-carboxamide.
| Compound Name | N-(2,4-dibromophenyl)-4-(2-methoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 3746837 |
| Molecular Formula | C19H20Br2N2O2 |
| Molecular Weight | 468.19 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | N-(2,4-dibromophenyl)-4-(2-methoxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1ccccc1C1CCN(C(=O)Nc2ccc(Br)cc2Br)CC1 |
| InChI | InChI=1S/C19H20Br2N2O2/c1-25-18-5-3-2-4-15(18)13-8-10-23(11-9-13)19(24)22-17-7-6-14(20)12-16(17)21/h2-7,12-13H,8-11H2,1H3,(H,22,24) |
| InChIKey | ONVQKSDFTXBLLY-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.19 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |