C11H12Br2N2O3S — CID 56556433
N-(2,4-dibromophenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide (PubChem CID 56556433) has the molecular formula C11H12Br2N2O3S and a molecular weight of 412.10 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide.
| Compound Name | N-(2,4-dibromophenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
|---|---|
| PubChem CID | 56556433 |
| Molecular Formula | C11H12Br2N2O3S |
| Molecular Weight | 412.10 g/mol |
| Exact Mass | 409.89 |
| IUPAC Name | N-(2,4-dibromophenyl)-1,1-dioxo-1,4-thiazinane-4-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1Br)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H12Br2N2O3S/c12-8-1-2-10(9(13)7-8)14-11(16)15-3-5-19(17,18)6-4-15/h1-2,7H,3-6H2,(H,14,16) |
| InChIKey | BLKHWYAJLQMASF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |