C11H13BrFN3O — CID 171854873
N-(4-bromo-2-fluorophenyl)piperazine-1-carboxamide (PubChem CID 171854873) has the molecular formula C11H13BrFN3O and a molecular weight of 302.15 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 171854873 |
| Molecular Formula | C11H13BrFN3O |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C11H13BrFN3O/c12-8-1-2-10(9(13)7-8)15-11(17)16-5-3-14-4-6-16/h1-2,7,14H,3-6H2,(H,15,17) |
| InChIKey | UVUBYVKAIUPTBS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |