C11H13F2N3O — CID 43288448
N-(2,4-difluorophenyl)piperazine-1-carboxamide (PubChem CID 43288448) has the molecular formula C11H13F2N3O and a molecular weight of 241.24 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)piperazine-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 43288448 |
| Molecular Formula | C11H13F2N3O |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-(2,4-difluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)N1CCNCC1 |
| InChI | InChI=1S/C11H13F2N3O/c12-8-1-2-10(9(13)7-8)15-11(17)16-5-3-14-4-6-16/h1-2,7,14H,3-6H2,(H,15,17) |
| InChIKey | HLFMAANNMCCSMF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |