C19H17F3N2O2 — CID 24761982
N-(2,4-difluorophenyl)-4-(4-fluorobenzoyl)piperidine-1-carboxamide (PubChem CID 24761982) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-4-(4-fluorobenzoyl)piperidine-1-carboxamide.
| Compound Name | N-(2,4-difluorophenyl)-4-(4-fluorobenzoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 24761982 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | N-(2,4-difluorophenyl)-4-(4-fluorobenzoyl)piperidine-1-carboxamide |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C19H17F3N2O2/c20-14-3-1-12(2-4-14)18(25)13-7-9-24(10-8-13)19(26)23-17-6-5-15(21)11-16(17)22/h1-6,11,13H,7-10H2,(H,23,26) |
| InChIKey | FNJBMBQLXAXUAA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |