C15H21F2N3O — CID 95723660
(4S)-N-(2,4-difluorophenyl)-4-(dimethylamino)azepane-1-carboxamide (PubChem CID 95723660) has the molecular formula C15H21F2N3O and a molecular weight of 297.35 g/mol. Its IUPAC name is (4S)-N-(2,4-difluorophenyl)-4-(dimethylamino)azepane-1-carboxamide.
| Compound Name | (4S)-N-(2,4-difluorophenyl)-4-(dimethylamino)azepane-1-carboxamide |
|---|---|
| PubChem CID | 95723660 |
| Molecular Formula | C15H21F2N3O |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (4S)-N-(2,4-difluorophenyl)-4-(dimethylamino)azepane-1-carboxamide |
| SMILES | CN(C)[C@H]1CCCN(C(=O)Nc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C15H21F2N3O/c1-19(2)12-4-3-8-20(9-7-12)15(21)18-14-6-5-11(16)10-13(14)17/h5-6,10,12H,3-4,7-9H2,1-2H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | MWRCWHYZEZDASI-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |