C20H23F2N3O — CID 97350787
(3S)-N-(2,4-difluorophenyl)-3-(N,4-dimethylanilino)piperidine-1-carboxamide (PubChem CID 97350787) has the molecular formula C20H23F2N3O and a molecular weight of 359.42 g/mol. Its IUPAC name is (3S)-N-(2,4-difluorophenyl)-3-(N,4-dimethylanilino)piperidine-1-carboxamide.
| Compound Name | (3S)-N-(2,4-difluorophenyl)-3-(N,4-dimethylanilino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 97350787 |
| Molecular Formula | C20H23F2N3O |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3S)-N-(2,4-difluorophenyl)-3-(N,4-dimethylanilino)piperidine-1-carboxamide |
| SMILES | Cc1ccc(N(C)[C@H]2CCCN(C(=O)Nc3ccc(F)cc3F)C2)cc1 |
| InChI | InChI=1S/C20H23F2N3O/c1-14-5-8-16(9-6-14)24(2)17-4-3-11-25(13-17)20(26)23-19-10-7-15(21)12-18(19)22/h5-10,12,17H,3-4,11,13H2,1-2H3,(H,23,26)/t17-/m0/s1 |
| InChIKey | XVRMJODXUHBWQB-KRWDZBQOSA-N |
| XLogP | 4.41 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|